C15H16O6 — CID 10565549
(7-methoxy-2-oxochromen-4-yl)methyl 4-hydroxybutanoate (PubChem CID 10565549) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 4-hydroxybutanoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-hydroxybutanoate |
|---|---|
| PubChem CID | 10565549 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 4-hydroxybutanoate |
| SMILES | COc1ccc2c(COC(=O)CCCO)cc(=O)oc2c1 |
| InChI | InChI=1S/C15H16O6/c1-19-11-4-5-12-10(7-15(18)21-13(12)8-11)9-20-14(17)3-2-6-16/h4-5,7-8,16H,2-3,6,9H2,1H3 |
| InChIKey | CDICZBMFDGPWOT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|