C19H18N2O5S — CID 8852922
(7-methoxy-2-oxochromen-4-yl)methyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate (PubChem CID 8852922) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 8852922 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
| SMILES | COc1ccc2c(COC(=O)CSc3nc(C)cc(C)n3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H18N2O5S/c1-11-6-12(2)21-19(20-11)27-10-18(23)25-9-13-7-17(22)26-16-8-14(24-3)4-5-15(13)16/h4-8H,9-10H2,1-3H3 |
| InChIKey | MELMBPXDDLSZRH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|