C21H15ClN2O6S — CID 5210794
(7-methoxy-2-oxochromen-4-yl)methyl 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 5210794) has the molecular formula C21H15ClN2O6S and a molecular weight of 458.88 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 5210794 |
| Molecular Formula | C21H15ClN2O6S |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | COc1ccc2c(COC(=O)CSc3nnc(-c4ccc(Cl)cc4)o3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H15ClN2O6S/c1-27-15-6-7-16-13(8-18(25)29-17(16)9-15)10-28-19(26)11-31-21-24-23-20(30-21)12-2-4-14(22)5-3-12/h2-9H,10-11H2,1H3 |
| InChIKey | SFRQRPFOGOXICY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 104.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|