C21H20O5 — CID 7227766
(7-methoxy-2-oxochromen-4-yl)methyl (3S)-3-phenylbutanoate (PubChem CID 7227766) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl (3S)-3-phenylbutanoate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl (3S)-3-phenylbutanoate |
|---|---|
| PubChem CID | 7227766 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl (3S)-3-phenylbutanoate |
| SMILES | COc1ccc2c(COC(=O)C[C@H](C)c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H20O5/c1-14(15-6-4-3-5-7-15)10-20(22)25-13-16-11-21(23)26-19-12-17(24-2)8-9-18(16)19/h3-9,11-12,14H,10,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | SKYAZZTXADBLNZ-AWEZNQCLSA-N |
| XLogP | 4.04 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|