C19H20NO3+ — CID 2714020
(7-methoxy-2-oxochromen-4-yl)methyl-[(1R)-1-phenylethyl]azanium (PubChem CID 2714020) has the molecular formula C19H20NO3+ and a molecular weight of 310.37 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl-[(1R)-1-phenylethyl]azanium.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 2714020 |
| Molecular Formula | C19H20NO3+ |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl-[(1R)-1-phenylethyl]azanium |
| SMILES | COc1ccc2c(C[NH2+][C@H](C)c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H19NO3/c1-13(14-6-4-3-5-7-14)20-12-15-10-19(21)23-18-11-16(22-2)8-9-17(15)18/h3-11,13,20H,12H2,1-2H3/p+1/t13-/m1/s1 |
| InChIKey | ZMZBBLNORXCKHE-CYBMUJFWSA-O |
| XLogP | 2.63 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|