C20H21BrNO4+ — CID 9001426
[(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium (PubChem CID 9001426) has the molecular formula C20H21BrNO4+ and a molecular weight of 419.30 g/mol. Its IUPAC name is [(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | [(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9001426 |
| Molecular Formula | C20H21BrNO4+ |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | [(1S)-1-(3-bromo-4-methoxyphenyl)ethyl]-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium |
| SMILES | COc1ccc2c(C[NH2+][C@@H](C)c3ccc(OC)c(Br)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H20BrNO4/c1-12(13-4-7-18(25-3)17(21)8-13)22-11-14-9-20(23)26-19-10-15(24-2)5-6-16(14)19/h4-10,12,22H,11H2,1-3H3/p+1/t12-/m0/s1 |
| InChIKey | JQBQHHWTGKJDFV-LBPRGKRZSA-O |
| XLogP | 3.40 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|