C22H28N2O4+2 — CID 9262912
[(1S)-2-[(7-methoxy-2-oxochromen-4-yl)methylazaniumyl]-1-(2-methoxyphenyl)ethyl]-dimethylazanium (PubChem CID 9262912) has the molecular formula C22H28N2O4+2 and a molecular weight of 384.48 g/mol. Its IUPAC name is [(1S)-2-[(7-methoxy-2-oxochromen-4-yl)methylazaniumyl]-1-(2-methoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(7-methoxy-2-oxochromen-4-yl)methylazaniumyl]-1-(2-methoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 9262912 |
| Molecular Formula | C22H28N2O4+2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(1S)-2-[(7-methoxy-2-oxochromen-4-yl)methylazaniumyl]-1-(2-methoxyphenyl)ethyl]-dimethylazanium |
| SMILES | COc1ccc2c(C[NH2+]C[C@H](c3ccccc3OC)[NH+](C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H26N2O4/c1-24(2)19(18-7-5-6-8-20(18)27-4)14-23-13-15-11-22(25)28-21-12-16(26-3)9-10-17(15)21/h5-12,19,23H,13-14H2,1-4H3/p+2/t19-/m1/s1 |
| InChIKey | LEHAVNLJYWTTIH-LJQANCHMSA-P |
| XLogP | 0.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|