C23H30N2O3+2 — CID 9262944
[(1S)-2-[(7-ethyl-2-oxochromen-4-yl)methylazaniumyl]-1-(2-methoxyphenyl)ethyl]-dimethylazanium (PubChem CID 9262944) has the molecular formula C23H30N2O3+2 and a molecular weight of 382.50 g/mol. Its IUPAC name is [(1S)-2-[(7-ethyl-2-oxochromen-4-yl)methylazaniumyl]-1-(2-methoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[(7-ethyl-2-oxochromen-4-yl)methylazaniumyl]-1-(2-methoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 9262944 |
| Molecular Formula | C23H30N2O3+2 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | [(1S)-2-[(7-ethyl-2-oxochromen-4-yl)methylazaniumyl]-1-(2-methoxyphenyl)ethyl]-dimethylazanium |
| SMILES | CCc1ccc2c(C[NH2+]C[C@H](c3ccccc3OC)[NH+](C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H28N2O3/c1-5-16-10-11-18-17(13-23(26)28-22(18)12-16)14-24-15-20(25(2)3)19-8-6-7-9-21(19)27-4/h6-13,20,24H,5,14-15H2,1-4H3/p+2/t20-/m1/s1 |
| InChIKey | CZTLVZBECIPHEZ-HXUWFJFHSA-P |
| XLogP | 1.31 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|