C21H24NO3+ — CID 9256303
(7-ethyl-2-oxochromen-4-yl)methyl-[2-(4-methoxyphenyl)ethyl]azanium (PubChem CID 9256303) has the molecular formula C21H24NO3+ and a molecular weight of 338.43 g/mol. Its IUPAC name is (7-ethyl-2-oxochromen-4-yl)methyl-[2-(4-methoxyphenyl)ethyl]azanium.
| Compound Name | (7-ethyl-2-oxochromen-4-yl)methyl-[2-(4-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9256303 |
| Molecular Formula | C21H24NO3+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (7-ethyl-2-oxochromen-4-yl)methyl-[2-(4-methoxyphenyl)ethyl]azanium |
| SMILES | CCc1ccc2c(C[NH2+]CCc3ccc(OC)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H23NO3/c1-3-15-6-9-19-17(13-21(23)25-20(19)12-15)14-22-11-10-16-4-7-18(24-2)8-5-16/h4-9,12-13,22H,3,10-11,14H2,1-2H3/p+1 |
| InChIKey | BWXKRLILRJATKU-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|