C21H24NO5+ — CID 9436663
2-(4-ethoxyphenoxy)ethyl-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium (PubChem CID 9436663) has the molecular formula C21H24NO5+ and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9436663 |
| Molecular Formula | C21H24NO5+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium |
| SMILES | CCOc1ccc(OCC[NH2+]Cc2cc(=O)oc3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-3-25-16-4-6-17(7-5-16)26-11-10-22-14-15-12-21(23)27-20-13-18(24-2)8-9-19(15)20/h4-9,12-13,22H,3,10-11,14H2,1-2H3/p+1 |
| InChIKey | DETJQEPEPOZRBI-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|