C22H26NO4+ — CID 9436669
(7,8-dimethyl-2-oxochromen-4-yl)methyl-[2-(4-ethoxyphenoxy)ethyl]azanium (PubChem CID 9436669) has the molecular formula C22H26NO4+ and a molecular weight of 368.45 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-[2-(4-ethoxyphenoxy)ethyl]azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[2-(4-ethoxyphenoxy)ethyl]azanium |
|---|---|
| PubChem CID | 9436669 |
| Molecular Formula | C22H26NO4+ |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[2-(4-ethoxyphenoxy)ethyl]azanium |
| SMILES | CCOc1ccc(OCC[NH2+]Cc2cc(=O)oc3c(C)c(C)ccc23)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-4-25-18-6-8-19(9-7-18)26-12-11-23-14-17-13-21(24)27-22-16(3)15(2)5-10-20(17)22/h5-10,13,23H,4,11-12,14H2,1-3H3/p+1 |
| InChIKey | KZQZGFWSUUYQCA-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|