C19H19FNO2+ — CID 9256570
(7,8-dimethyl-2-oxochromen-4-yl)methyl-[(4-fluorophenyl)methyl]azanium (PubChem CID 9256570) has the molecular formula C19H19FNO2+ and a molecular weight of 312.36 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(4-fluorophenyl)methyl]azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 9256570 |
| Molecular Formula | C19H19FNO2+ |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(4-fluorophenyl)methyl]azanium |
| SMILES | Cc1ccc2c(C[NH2+]Cc3ccc(F)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C19H18FNO2/c1-12-3-8-17-15(9-18(22)23-19(17)13(12)2)11-21-10-14-4-6-16(20)7-5-14/h3-9,21H,10-11H2,1-2H3/p+1 |
| InChIKey | JWKRGYJESMFBPQ-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|