C25H26NO2S+ — CID 8769250
(7,8-dimethyl-2-oxochromen-4-yl)methyl-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 8769250) has the molecular formula C25H26NO2S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 8769250 |
| Molecular Formula | C25H26NO2S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(R)-(4-ethylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | CCc1ccc([C@@H]([NH2+]Cc2cc(=O)oc3c(C)c(C)ccc23)c2cccs2)cc1 |
| InChI | InChI=1S/C25H25NO2S/c1-4-18-8-10-19(11-9-18)24(22-6-5-13-29-22)26-15-20-14-23(27)28-25-17(3)16(2)7-12-21(20)25/h5-14,24,26H,4,15H2,1-3H3/p+1/t24-/m1/s1 |
| InChIKey | BEJDHXFRSCBJOM-XMMPIXPASA-O |
| XLogP | 4.89 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|