C22H26NO2+ — CID 9436997
(7,8-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-1-phenylbutyl]azanium (PubChem CID 9436997) has the molecular formula C22H26NO2+ and a molecular weight of 336.46 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-1-phenylbutyl]azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-1-phenylbutyl]azanium |
|---|---|
| PubChem CID | 9436997 |
| Molecular Formula | C22H26NO2+ |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-1-phenylbutyl]azanium |
| SMILES | CCC[C@H]([NH2+]Cc1cc(=O)oc2c(C)c(C)ccc12)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2/c1-4-8-20(17-9-6-5-7-10-17)23-14-18-13-21(24)25-22-16(3)15(2)11-12-19(18)22/h5-7,9-13,20,23H,4,8,14H2,1-3H3/p+1/t20-/m0/s1 |
| InChIKey | RXXVTWYLYYAAHN-FQEVSTJZSA-O |
| XLogP | 4.01 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|