C22H25FNO2+ — CID 9133757
(7,8-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]azanium (PubChem CID 9133757) has the molecular formula C22H25FNO2+ and a molecular weight of 354.45 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 9133757 |
| Molecular Formula | C22H25FNO2+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
| SMILES | Cc1ccc2c(C[NH2+][C@H](c3ccc(F)cc3)C(C)C)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H24FNO2/c1-13(2)21(16-6-8-18(23)9-7-16)24-12-17-11-20(25)26-22-15(4)14(3)5-10-19(17)22/h5-11,13,21,24H,12H2,1-4H3/p+1/t21-/m0/s1 |
| InChIKey | NMBIUUIBESESFN-NRFANRHFSA-O |
| XLogP | 4.01 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|