C21H19FO4 — CID 8552924
(7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(4-fluorophenyl)propanoate (PubChem CID 8552924) has the molecular formula C21H19FO4 and a molecular weight of 354.38 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(4-fluorophenyl)propanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 8552924 |
| Molecular Formula | C21H19FO4 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(4-fluorophenyl)propanoate |
| SMILES | Cc1ccc2c(COC(=O)CCc3ccc(F)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H19FO4/c1-13-3-9-18-16(11-20(24)26-21(18)14(13)2)12-25-19(23)10-6-15-4-7-17(22)8-5-15/h3-5,7-9,11H,6,10,12H2,1-2H3 |
| InChIKey | VFPJXHMYHXJKNL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|