C21H19Cl2NO6S — CID 2495909
(7,8-dimethyl-2-oxochromen-4-yl)methyl 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate (PubChem CID 2495909) has the molecular formula C21H19Cl2NO6S and a molecular weight of 484.36 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2495909 |
| Molecular Formula | C21H19Cl2NO6S |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-[(2,6-dichlorophenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc2c(COC(=O)CCNS(=O)(=O)c3c(Cl)cccc3Cl)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H19Cl2NO6S/c1-12-6-7-15-14(10-19(26)30-20(15)13(12)2)11-29-18(25)8-9-24-31(27,28)21-16(22)4-3-5-17(21)23/h3-7,10,24H,8-9,11H2,1-2H3 |
| InChIKey | IESQNDGFVRYTSV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|