C24H26O6 — CID 7147642
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(2-ethoxyphenoxy)butanoate (PubChem CID 7147642) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(2-ethoxyphenoxy)butanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(2-ethoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 7147642 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(2-ethoxyphenoxy)butanoate |
| SMILES | CCOc1ccccc1OCCCC(=O)OCc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C24H26O6/c1-4-27-20-8-5-6-9-21(20)28-13-7-10-22(25)29-15-18-14-23(26)30-24-17(3)16(2)11-12-19(18)24/h5-6,8-9,11-12,14H,4,7,10,13,15H2,1-3H3 |
| InChIKey | ZHXVDVOFMSEATE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|