C23H20N2O5 — CID 55444218
(7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(4-oxocinnolin-1-yl)propanoate (PubChem CID 55444218) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(4-oxocinnolin-1-yl)propanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(4-oxocinnolin-1-yl)propanoate |
|---|---|
| PubChem CID | 55444218 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(4-oxocinnolin-1-yl)propanoate |
| SMILES | Cc1ccc2c(COC(=O)CCn3ncc(=O)c4ccccc43)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H20N2O5/c1-14-7-8-17-16(11-22(28)30-23(17)15(14)2)13-29-21(27)9-10-25-19-6-4-3-5-18(19)20(26)12-24-25/h3-8,11-12H,9-10,13H2,1-2H3 |
| InChIKey | HSDWRXHUUNOCOL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 91.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|