C22H21BrO5 — CID 3994960
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(3-bromophenoxy)butanoate (PubChem CID 3994960) has the molecular formula C22H21BrO5 and a molecular weight of 445.31 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(3-bromophenoxy)butanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(3-bromophenoxy)butanoate |
|---|---|
| PubChem CID | 3994960 |
| Molecular Formula | C22H21BrO5 |
| Molecular Weight | 445.31 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(3-bromophenoxy)butanoate |
| SMILES | Cc1ccc2c(COC(=O)CCCOc3cccc(Br)c3)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H21BrO5/c1-14-8-9-19-16(11-21(25)28-22(19)15(14)2)13-27-20(24)7-4-10-26-18-6-3-5-17(23)12-18/h3,5-6,8-9,11-12H,4,7,10,13H2,1-2H3 |
| InChIKey | GHHMXTNHLCCHIO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|