C27H24O6 — CID 4666775
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(2-phenoxyethoxy)benzoate (PubChem CID 4666775) has the molecular formula C27H24O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(2-phenoxyethoxy)benzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(2-phenoxyethoxy)benzoate |
|---|---|
| PubChem CID | 4666775 |
| Molecular Formula | C27H24O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(2-phenoxyethoxy)benzoate |
| SMILES | Cc1ccc2c(COC(=O)c3ccccc3OCCOc3ccccc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C27H24O6/c1-18-12-13-22-20(16-25(28)33-26(22)19(18)2)17-32-27(29)23-10-6-7-11-24(23)31-15-14-30-21-8-4-3-5-9-21/h3-13,16H,14-15,17H2,1-2H3 |
| InChIKey | IDEYTWKFUDPEBX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|