C24H19NO6 — CID 7841115
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(furan-2-carbonylamino)benzoate (PubChem CID 7841115) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(furan-2-carbonylamino)benzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 7841115 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-(furan-2-carbonylamino)benzoate |
| SMILES | Cc1ccc2c(COC(=O)c3ccccc3NC(=O)c3ccco3)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H19NO6/c1-14-9-10-17-16(12-21(26)31-22(17)15(14)2)13-30-24(28)18-6-3-4-7-19(18)25-23(27)20-8-5-11-29-20/h3-12H,13H2,1-2H3,(H,25,27) |
| InChIKey | CYXVSHHWTIUERL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|