C24H18ClNO6 — CID 16534296
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 16534296) has the molecular formula C24H18ClNO6 and a molecular weight of 451.86 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 16534296 |
| Molecular Formula | C24H18ClNO6 |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)c3ccc(C)c(NC(=O)c4ccco4)c3)c2cc1Cl |
| InChI | InChI=1S/C24H18ClNO6/c1-13-5-6-15(9-19(13)26-23(28)20-4-3-7-30-20)24(29)31-12-16-10-22(27)32-21-8-14(2)18(25)11-17(16)21/h3-11H,12H2,1-2H3,(H,26,28) |
| InChIKey | HVROYAKMKDABCJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|