C22H19ClN2O5 — CID 2605504
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 2605504) has the molecular formula C22H19ClN2O5 and a molecular weight of 426.86 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 2605504 |
| Molecular Formula | C22H19ClN2O5 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NCc2ccccc2Cl)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C22H19ClN2O5/c1-14-8-9-15(11-18(14)25-21(27)19-7-4-10-29-19)22(28)30-13-20(26)24-12-16-5-2-3-6-17(16)23/h2-11H,12-13H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | DQZYTMKGIZZSPR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |