C20H22N2O6 — CID 2605528
[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate (PubChem CID 2605528) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate.
| Compound Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
|---|---|
| PubChem CID | 2605528 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl] 3-(furan-2-carbonylamino)-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC[C@@H]2CCCO2)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H22N2O6/c1-13-6-7-14(10-16(13)22-19(24)17-5-3-9-27-17)20(25)28-12-18(23)21-11-15-4-2-8-26-15/h3,5-7,9-10,15H,2,4,8,11-12H2,1H3,(H,21,23)(H,22,24)/t15-/m0/s1 |
| InChIKey | ALTNNKUGVRLVJE-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |