C24H24FNO5 — CID 51556586
(7,8-dimethyl-2-oxochromen-4-yl)methyl (2R)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 51556586) has the molecular formula C24H24FNO5 and a molecular weight of 425.46 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (2R)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (2R)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 51556586 |
| Molecular Formula | C24H24FNO5 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (2R)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | Cc1ccc2c(COC(=O)[C@H](NC(=O)c3ccccc3F)C(C)C)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H24FNO5/c1-13(2)21(26-23(28)18-7-5-6-8-19(18)25)24(29)30-12-16-11-20(27)31-22-15(4)14(3)9-10-17(16)22/h5-11,13,21H,12H2,1-4H3,(H,26,28)/t21-/m1/s1 |
| InChIKey | QCHFZZDWDYPJQA-OAQYLSRUSA-N |
| XLogP | 4.05 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|