C26H25NO7S — CID 41082125
(7,8-dimethyl-2-oxochromen-4-yl)methyl (2S,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoate (PubChem CID 41082125) has the molecular formula C26H25NO7S and a molecular weight of 495.55 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (2S,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (2S,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 41082125 |
| Molecular Formula | C26H25NO7S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (2S,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoate |
| SMILES | Cc1ccc2c(COC(=O)[C@@H](NS(=O)(=O)c3ccc4ccccc4c3)[C@H](C)O)cc(=O)oc2c1C |
| InChI | InChI=1S/C26H25NO7S/c1-15-8-11-22-20(13-23(29)34-25(22)16(15)2)14-33-26(30)24(17(3)28)27-35(31,32)21-10-9-18-6-4-5-7-19(18)12-21/h4-13,17,24,27-28H,14H2,1-3H3/t17-,24-/m0/s1 |
| InChIKey | ORYZOSRHOXEIDP-XDHUDOTRSA-N |
| XLogP | 3.33 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|