C23H23ClO4 — CID 7209275
(7,8-dimethyl-2-oxochromen-4-yl)methyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7209275) has the molecular formula C23H23ClO4 and a molecular weight of 398.89 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7209275 |
| Molecular Formula | C23H23ClO4 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | Cc1ccc2c(COC(=O)[C@@H](c3ccc(Cl)cc3)C(C)C)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H23ClO4/c1-13(2)21(16-6-8-18(24)9-7-16)23(26)27-12-17-11-20(25)28-22-15(4)14(3)5-10-19(17)22/h5-11,13,21H,12H2,1-4H3/t21-/m1/s1 |
| InChIKey | VXKUSAZCNYCDPA-OAQYLSRUSA-N |
| XLogP | 5.55 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|