C21H16Cl2O4 — CID 4665231
(7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 4665231) has the molecular formula C21H16Cl2O4 and a molecular weight of 403.26 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4665231 |
| Molecular Formula | C21H16Cl2O4 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | Cc1ccc2c(COC(=O)C=Cc3ccc(Cl)c(Cl)c3)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H16Cl2O4/c1-12-3-6-16-15(10-20(25)27-21(16)13(12)2)11-26-19(24)8-5-14-4-7-17(22)18(23)9-14/h3-10H,11H2,1-2H3 |
| InChIKey | PPBUHTZETQRNIR-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|