C18H17NO5 — CID 3620869
(7,8-dimethyl-2-oxochromen-4-yl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate (PubChem CID 3620869) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 3620869 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)c3c(C)noc3C)cc(=O)oc2c1C |
| InChI | InChI=1S/C18H17NO5/c1-9-5-6-14-13(7-15(20)23-17(14)10(9)2)8-22-18(21)16-11(3)19-24-12(16)4/h5-7H,8H2,1-4H3 |
| InChIKey | WEXUXTMRGLTKTO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|