C26H25NO7 — CID 3380190
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate (PubChem CID 3380190) has the molecular formula C26H25NO7 and a molecular weight of 463.49 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 3380190 |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2cc(=O)oc3c(C)c(C)ccc23)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C26H25NO7/c1-14-6-8-20-19(11-24(28)33-25(20)15(14)2)12-32-26(29)18-7-9-22(23(10-18)30-5)31-13-21-16(3)27-34-17(21)4/h6-11H,12-13H2,1-5H3 |
| InChIKey | MLIPYQOHYZGJOD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 101.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|