C23H25NO7 — CID 5244662
2-(4-methoxyphenoxy)ethyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate (PubChem CID 5244662) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 5244662 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxybenzoate |
| SMILES | COc1ccc(OCCOC(=O)c2ccc(OCc3c(C)noc3C)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H25NO7/c1-15-20(16(2)31-24-15)14-30-21-10-5-17(13-22(21)27-4)23(25)29-12-11-28-19-8-6-18(26-3)7-9-19/h5-10,13H,11-12,14H2,1-4H3 |
| InChIKey | LFOKXYQKSRXLHQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|