C21H20ClNO5 — CID 8850253
2-(3-chlorophenoxy)ethyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate (PubChem CID 8850253) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 8850253 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoate |
| SMILES | Cc1noc(C)c1COc1ccc(C(=O)OCCOc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H20ClNO5/c1-14-20(15(2)28-23-14)13-27-18-8-6-16(7-9-18)21(24)26-11-10-25-19-5-3-4-17(22)12-19/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | UBVQCQAZMXIURP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|