C25H30N2O5 — CID 55799586
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxy-N-[4-(4-methylphenoxy)butyl]benzamide (PubChem CID 55799586) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxy-N-[4-(4-methylphenoxy)butyl]benzamide.
| Compound Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxy-N-[4-(4-methylphenoxy)butyl]benzamide |
|---|---|
| PubChem CID | 55799586 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methoxy-N-[4-(4-methylphenoxy)butyl]benzamide |
| SMILES | COc1cc(C(=O)NCCCCOc2ccc(C)cc2)ccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C25H30N2O5/c1-17-7-10-21(11-8-17)30-14-6-5-13-26-25(28)20-9-12-23(24(15-20)29-4)31-16-22-18(2)27-32-19(22)3/h7-12,15H,5-6,13-14,16H2,1-4H3,(H,26,28) |
| InChIKey | WIDYWYDBAUIHTB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|