C16H20N2O4 — CID 110646263
N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 110646263) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 110646263 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCc2c(C)noc2C)cc1OC |
| InChI | InChI=1S/C16H20N2O4/c1-10-13(11(2)22-18-10)7-8-17-16(19)12-5-6-14(20-3)15(9-12)21-4/h5-6,9H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | SSDDDLUOOJBGQA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |