C14H16N2O4 — CID 51098103
N-(3,5-dimethyl-1,2-oxazol-4-yl)-3,4-dimethoxybenzamide (PubChem CID 51098103) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2-oxazol-4-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 51098103 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(C)noc2C)cc1OC |
| InChI | InChI=1S/C14H16N2O4/c1-8-13(9(2)20-16-8)15-14(17)10-5-6-11(18-3)12(7-10)19-4/h5-7H,1-4H3,(H,15,17) |
| InChIKey | ALIQCMHMESYIOA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |