C15H18N2O4 — CID 87043417
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3,4-dimethoxybenzamide (PubChem CID 87043417) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 87043417 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2nc(C)c(C)o2)cc1OC |
| InChI | InChI=1S/C15H18N2O4/c1-9-10(2)21-14(17-9)8-16-15(18)11-5-6-12(19-3)13(7-11)20-4/h5-7H,8H2,1-4H3,(H,16,18) |
| InChIKey | TUXSWEYVMBJMHK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |