C14H15N3O2S — CID 106372305
3-carbamothioyl-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]benzamide (PubChem CID 106372305) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 3-carbamothioyl-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]benzamide.
| Compound Name | 3-carbamothioyl-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 106372305 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-carbamothioyl-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]benzamide |
| SMILES | Cc1nc(CNC(=O)c2cccc(C(N)=S)c2)oc1C |
| InChI | InChI=1S/C14H15N3O2S/c1-8-9(2)19-12(17-8)7-16-14(18)11-5-3-4-10(6-11)13(15)20/h3-6H,7H2,1-2H3,(H2,15,20)(H,16,18) |
| InChIKey | PCFZEWKPZGBQKF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|