C13H14N4O2S — CID 106372341
5-carbamothioyl-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]pyridine-2-carboxamide (PubChem CID 106372341) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 5-carbamothioyl-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106372341 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 5-carbamothioyl-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]pyridine-2-carboxamide |
| SMILES | Cc1nc(CNC(=O)c2ccc(C(N)=S)cn2)oc1C |
| InChI | InChI=1S/C13H14N4O2S/c1-7-8(2)19-11(17-7)6-16-13(18)10-4-3-9(5-15-10)12(14)20/h3-5H,6H2,1-2H3,(H2,14,20)(H,16,18) |
| InChIKey | QTWDWFJQYRJVQC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|