C11H11N5O2S — CID 63749206
5-carbamothioyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-2-carboxamide (PubChem CID 63749206) has the molecular formula C11H11N5O2S and a molecular weight of 277.31 g/mol. Its IUPAC name is 5-carbamothioyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63749206 |
| Molecular Formula | C11H11N5O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-carbamothioyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-2-carboxamide |
| SMILES | Cc1noc(CNC(=O)c2ccc(C(N)=S)cn2)n1 |
| InChI | InChI=1S/C11H11N5O2S/c1-6-15-9(18-16-6)5-14-11(17)8-3-2-7(4-13-8)10(12)19/h2-4H,5H2,1H3,(H2,12,19)(H,14,17) |
| InChIKey | XPQIHYXWQIKPRT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|