C13H15N5OS — CID 106035328
5-carbamothioyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-2-carboxamide (PubChem CID 106035328) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 5-carbamothioyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106035328 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 5-carbamothioyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-2-carboxamide |
| SMILES | Cc1c(CNC(=O)c2ccc(C(N)=S)cn2)cnn1C |
| InChI | InChI=1S/C13H15N5OS/c1-8-10(7-17-18(8)2)6-16-13(19)11-4-3-9(5-15-11)12(14)20/h3-5,7H,6H2,1-2H3,(H2,14,20)(H,16,19) |
| InChIKey | JHARGXUTPAVAEZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|