C12H13BrN4O — CID 103861052
6-bromo-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-3-carboxamide (PubChem CID 103861052) has the molecular formula C12H13BrN4O and a molecular weight of 309.17 g/mol. Its IUPAC name is 6-bromo-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103861052 |
| Molecular Formula | C12H13BrN4O |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 6-bromo-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-3-carboxamide |
| SMILES | Cc1c(CNC(=O)c2ccc(Br)nc2)cnn1C |
| InChI | InChI=1S/C12H13BrN4O/c1-8-10(7-16-17(8)2)6-15-12(18)9-3-4-11(13)14-5-9/h3-5,7H,6H2,1-2H3,(H,15,18) |
| InChIKey | RRDRQZRTXDUKAE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|