C11H10BrN3OS — CID 66462161
6-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]pyridine-3-carboxamide (PubChem CID 66462161) has the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. Its IUPAC name is 6-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66462161 |
| Molecular Formula | C11H10BrN3OS |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 6-bromo-N-[(2-methyl-1,3-thiazol-5-yl)methyl]pyridine-3-carboxamide |
| SMILES | Cc1ncc(CNC(=O)c2ccc(Br)nc2)s1 |
| InChI | InChI=1S/C11H10BrN3OS/c1-7-13-5-9(17-7)6-15-11(16)8-2-3-10(12)14-4-8/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | LNQVCJMHZJJWFH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|