C12H9F3N2OS — CID 63189301
3,4,5-trifluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide (PubChem CID 63189301) has the molecular formula C12H9F3N2OS and a molecular weight of 286.28 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide.
| Compound Name | 3,4,5-trifluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 63189301 |
| Molecular Formula | C12H9F3N2OS |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 3,4,5-trifluoro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide |
| SMILES | Cc1ncc(CNC(=O)c2cc(F)c(F)c(F)c2)s1 |
| InChI | InChI=1S/C12H9F3N2OS/c1-6-16-4-8(19-6)5-17-12(18)7-2-9(13)11(15)10(14)3-7/h2-4H,5H2,1H3,(H,17,18) |
| InChIKey | LUTQULUXNMRPHJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|