C12H11ClN2OS — CID 39855026
4-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide (PubChem CID 39855026) has the molecular formula C12H11ClN2OS and a molecular weight of 266.75 g/mol. Its IUPAC name is 4-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide.
| Compound Name | 4-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 39855026 |
| Molecular Formula | C12H11ClN2OS |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 4-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzamide |
| SMILES | Cc1ncc(CNC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C12H11ClN2OS/c1-8-14-6-11(17-8)7-15-12(16)9-2-4-10(13)5-3-9/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | LYAKJYFJVOQXTL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |