C13H9BrF2N2O — CID 66464932
6-bromo-N-[(2,5-difluorophenyl)methyl]pyridine-3-carboxamide (PubChem CID 66464932) has the molecular formula C13H9BrF2N2O and a molecular weight of 327.13 g/mol. Its IUPAC name is 6-bromo-N-[(2,5-difluorophenyl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-[(2,5-difluorophenyl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66464932 |
| Molecular Formula | C13H9BrF2N2O |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 6-bromo-N-[(2,5-difluorophenyl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1F)c1ccc(Br)nc1 |
| InChI | InChI=1S/C13H9BrF2N2O/c14-12-4-1-8(6-17-12)13(19)18-7-9-5-10(15)2-3-11(9)16/h1-6H,7H2,(H,18,19) |
| InChIKey | WTIRGTNXILHQQQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|