C14H10F3NOS — CID 107030045
N-[(2,5-difluorophenyl)methyl]-4-fluoro-3-sulfanylbenzamide (PubChem CID 107030045) has the molecular formula C14H10F3NOS and a molecular weight of 297.30 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-4-fluoro-3-sulfanylbenzamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-4-fluoro-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107030045 |
| Molecular Formula | C14H10F3NOS |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-4-fluoro-3-sulfanylbenzamide |
| SMILES | O=C(NCc1cc(F)ccc1F)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C14H10F3NOS/c15-10-2-4-11(16)9(5-10)7-18-14(19)8-1-3-12(17)13(20)6-8/h1-6,20H,7H2,(H,18,19) |
| InChIKey | BVIAYABZLZXBBG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|