C12H20N4OS — CID 106035313
2-carbamothioyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-methylbutanamide (PubChem CID 106035313) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 2-carbamothioyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106035313 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-carbamothioyl-N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-methylbutanamide |
| SMILES | Cc1c(CNC(=O)C(C(N)=S)C(C)C)cnn1C |
| InChI | InChI=1S/C12H20N4OS/c1-7(2)10(11(13)18)12(17)14-5-9-6-15-16(4)8(9)3/h6-7,10H,5H2,1-4H3,(H2,13,18)(H,14,17) |
| InChIKey | GLIOTBCYPXZLLV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|