C9H17N5O — CID 83110053
2-[(1,5-dimethylpyrazol-4-yl)methylamino]ethylurea (PubChem CID 83110053) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-[(1,5-dimethylpyrazol-4-yl)methylamino]ethylurea.
| Compound Name | 2-[(1,5-dimethylpyrazol-4-yl)methylamino]ethylurea |
|---|---|
| PubChem CID | 83110053 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-[(1,5-dimethylpyrazol-4-yl)methylamino]ethylurea |
| SMILES | Cc1c(CNCCNC(N)=O)cnn1C |
| InChI | InChI=1S/C9H17N5O/c1-7-8(6-13-14(7)2)5-11-3-4-12-9(10)15/h6,11H,3-5H2,1-2H3,(H3,10,12,15) |
| InChIKey | VFDZXZIERUUDJO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|