C10H17N5O2 — CID 106033656
N-(2-aminoethyl)-N'-[(1,5-dimethylpyrazol-4-yl)methyl]oxamide (PubChem CID 106033656) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[(1,5-dimethylpyrazol-4-yl)methyl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-[(1,5-dimethylpyrazol-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 106033656 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-(2-aminoethyl)-N'-[(1,5-dimethylpyrazol-4-yl)methyl]oxamide |
| SMILES | Cc1c(CNC(=O)C(=O)NCCN)cnn1C |
| InChI | InChI=1S/C10H17N5O2/c1-7-8(6-14-15(7)2)5-13-10(17)9(16)12-4-3-11/h6H,3-5,11H2,1-2H3,(H,12,16)(H,13,17) |
| InChIKey | CYKZSJTYEMRBPO-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|